C19H24F2N2O2 — CID 90624370
1-(2,6-difluorophenyl)-3-[(2-methoxy-2-adamantyl)methyl]urea (PubChem CID 90624370) has the molecular formula C19H24F2N2O2 and a molecular weight of 350.41 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-3-[(2-methoxy-2-adamantyl)methyl]urea.
| Compound Name | 1-(2,6-difluorophenyl)-3-[(2-methoxy-2-adamantyl)methyl]urea |
|---|---|
| PubChem CID | 90624370 |
| Molecular Formula | C19H24F2N2O2 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 1-(2,6-difluorophenyl)-3-[(2-methoxy-2-adamantyl)methyl]urea |
| SMILES | COC1(CNC(=O)Nc2c(F)cccc2F)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C19H24F2N2O2/c1-25-19(13-6-11-5-12(8-13)9-14(19)7-11)10-22-18(24)23-17-15(20)3-2-4-16(17)21/h2-4,11-14H,5-10H2,1H3,(H2,22,23,24) |
| InChIKey | DAPUKGSFWORRBN-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |