C21H29NO4 — CID 90624123
2,6-dimethoxy-N-[(2-methoxy-2-adamantyl)methyl]benzamide (PubChem CID 90624123) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is 2,6-dimethoxy-N-[(2-methoxy-2-adamantyl)methyl]benzamide.
| Compound Name | 2,6-dimethoxy-N-[(2-methoxy-2-adamantyl)methyl]benzamide |
|---|---|
| PubChem CID | 90624123 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 2,6-dimethoxy-N-[(2-methoxy-2-adamantyl)methyl]benzamide |
| SMILES | COc1cccc(OC)c1C(=O)NCC1(OC)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C21H29NO4/c1-24-17-5-4-6-18(25-2)19(17)20(23)22-12-21(26-3)15-8-13-7-14(10-15)11-16(21)9-13/h4-6,13-16H,7-12H2,1-3H3,(H,22,23) |
| InChIKey | FKFROPKVRMIKPH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |