C22H30N2O5 — CID 90624340
N'-(2,4-dimethoxyphenyl)-N-[(2-methoxy-2-adamantyl)methyl]oxamide (PubChem CID 90624340) has the molecular formula C22H30N2O5 and a molecular weight of 402.49 g/mol. Its IUPAC name is N'-(2,4-dimethoxyphenyl)-N-[(2-methoxy-2-adamantyl)methyl]oxamide.
| Compound Name | N'-(2,4-dimethoxyphenyl)-N-[(2-methoxy-2-adamantyl)methyl]oxamide |
|---|---|
| PubChem CID | 90624340 |
| Molecular Formula | C22H30N2O5 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | N'-(2,4-dimethoxyphenyl)-N-[(2-methoxy-2-adamantyl)methyl]oxamide |
| SMILES | COc1ccc(NC(=O)C(=O)NCC2(OC)C3CC4CC(C3)CC2C4)c(OC)c1 |
| InChI | InChI=1S/C22H30N2O5/c1-27-17-4-5-18(19(11-17)28-2)24-21(26)20(25)23-12-22(29-3)15-7-13-6-14(9-15)10-16(22)8-13/h4-5,11,13-16H,6-10,12H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | BPHCMQUDIDFECO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|