C17H21N3O — CID 90627307
8-azabicyclo[3.2.1]oct-2-en-8-yl-(1-pyridin-2-ylpyrrolidin-2-yl)methanone (PubChem CID 90627307) has the molecular formula C17H21N3O and a molecular weight of 283.37 g/mol. Its IUPAC name is 8-azabicyclo[3.2.1]oct-2-en-8-yl-(1-pyridin-2-ylpyrrolidin-2-yl)methanone.
| Compound Name | 8-azabicyclo[3.2.1]oct-2-en-8-yl-(1-pyridin-2-ylpyrrolidin-2-yl)methanone |
|---|---|
| PubChem CID | 90627307 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 8-azabicyclo[3.2.1]oct-2-en-8-yl-(1-pyridin-2-ylpyrrolidin-2-yl)methanone |
| SMILES | O=C(C1CCCN1c1ccccn1)N1C2C=CCC1CC2 |
| InChI | InChI=1S/C17H21N3O/c21-17(20-13-5-3-6-14(20)10-9-13)15-7-4-12-19(15)16-8-1-2-11-18-16/h1-3,5,8,11,13-15H,4,6-7,9-10,12H2 |
| InChIKey | IGODCXOUQTXXSB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|