C17H17ClN4O2S — CID 90628474
11-[(4-chlorophenyl)methylsulfonyl]-4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene (PubChem CID 90628474) has the molecular formula C17H17ClN4O2S and a molecular weight of 376.87 g/mol. Its IUPAC name is 11-[(4-chlorophenyl)methylsulfonyl]-4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene.
| Compound Name | 11-[(4-chlorophenyl)methylsulfonyl]-4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene |
|---|---|
| PubChem CID | 90628474 |
| Molecular Formula | C17H17ClN4O2S |
| Molecular Weight | 376.87 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 11-[(4-chlorophenyl)methylsulfonyl]-4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene |
| SMILES | Cc1cc2ncc3c(n2n1)CCN(S(=O)(=O)Cc1ccc(Cl)cc1)C3 |
| InChI | InChI=1S/C17H17ClN4O2S/c1-12-8-17-19-9-14-10-21(7-6-16(14)22(17)20-12)25(23,24)11-13-2-4-15(18)5-3-13/h2-5,8-9H,6-7,10-11H2,1H3 |
| InChIKey | NKQVVGZNKCLZIL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 67.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.87 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |