C20H21FN4O — CID 90628257
3-(3-fluoro-4-methylphenyl)-1-(4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-11-yl)propan-1-one (PubChem CID 90628257) has the molecular formula C20H21FN4O and a molecular weight of 352.41 g/mol. Its IUPAC name is 3-(3-fluoro-4-methylphenyl)-1-(4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-11-yl)propan-1-one.
| Compound Name | 3-(3-fluoro-4-methylphenyl)-1-(4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-11-yl)propan-1-one |
|---|---|
| PubChem CID | 90628257 |
| Molecular Formula | C20H21FN4O |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 3-(3-fluoro-4-methylphenyl)-1-(4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-11-yl)propan-1-one |
| SMILES | Cc1cc2ncc3c(n2n1)CCN(C(=O)CCc1ccc(C)c(F)c1)C3 |
| InChI | InChI=1S/C20H21FN4O/c1-13-3-4-15(10-17(13)21)5-6-20(26)24-8-7-18-16(12-24)11-22-19-9-14(2)23-25(18)19/h3-4,9-11H,5-8,12H2,1-2H3 |
| InChIKey | MPYJNOYQAORVML-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |