C20H23N5O3S — CID 90628205
2,5-dimethyl-N-[2-(4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-11-yl)-2-oxoethyl]benzenesulfonamide (PubChem CID 90628205) has the molecular formula C20H23N5O3S and a molecular weight of 413.50 g/mol. Its IUPAC name is 2,5-dimethyl-N-[2-(4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-11-yl)-2-oxoethyl]benzenesulfonamide.
| Compound Name | 2,5-dimethyl-N-[2-(4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-11-yl)-2-oxoethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 90628205 |
| Molecular Formula | C20H23N5O3S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 2,5-dimethyl-N-[2-(4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-11-yl)-2-oxoethyl]benzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NCC(=O)N2CCc3c(cnc4cc(C)nn34)C2)c1 |
| InChI | InChI=1S/C20H23N5O3S/c1-13-4-5-14(2)18(8-13)29(27,28)22-11-20(26)24-7-6-17-16(12-24)10-21-19-9-15(3)23-25(17)19/h4-5,8-10,22H,6-7,11-12H2,1-3H3 |
| InChIKey | TUYWCEMHMUUNFH-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |