C18H18FN5O3S — CID 90628214
3-fluoro-N-[2-(4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-11-yl)-2-oxoethyl]benzenesulfonamide (PubChem CID 90628214) has the molecular formula C18H18FN5O3S and a molecular weight of 403.44 g/mol. Its IUPAC name is 3-fluoro-N-[2-(4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-11-yl)-2-oxoethyl]benzenesulfonamide.
| Compound Name | 3-fluoro-N-[2-(4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-11-yl)-2-oxoethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 90628214 |
| Molecular Formula | C18H18FN5O3S |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 3-fluoro-N-[2-(4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-11-yl)-2-oxoethyl]benzenesulfonamide |
| SMILES | Cc1cc2ncc3c(n2n1)CCN(C(=O)CNS(=O)(=O)c1cccc(F)c1)C3 |
| InChI | InChI=1S/C18H18FN5O3S/c1-12-7-17-20-9-13-11-23(6-5-16(13)24(17)22-12)18(25)10-21-28(26,27)15-4-2-3-14(19)8-15/h2-4,7-9,21H,5-6,10-11H2,1H3 |
| InChIKey | CYYPZWPBCSUESP-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |