C19H21N5O3 — CID 90628412
N-(2,3-dimethoxyphenyl)-4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene-11-carboxamide (PubChem CID 90628412) has the molecular formula C19H21N5O3 and a molecular weight of 367.41 g/mol. Its IUPAC name is N-(2,3-dimethoxyphenyl)-4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene-11-carboxamide.
| Compound Name | N-(2,3-dimethoxyphenyl)-4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene-11-carboxamide |
|---|---|
| PubChem CID | 90628412 |
| Molecular Formula | C19H21N5O3 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | N-(2,3-dimethoxyphenyl)-4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene-11-carboxamide |
| SMILES | COc1cccc(NC(=O)N2CCc3c(cnc4cc(C)nn34)C2)c1OC |
| InChI | InChI=1S/C19H21N5O3/c1-12-9-17-20-10-13-11-23(8-7-15(13)24(17)22-12)19(25)21-14-5-4-6-16(26-2)18(14)27-3/h4-6,9-10H,7-8,11H2,1-3H3,(H,21,25) |
| InChIKey | GQLAWSDDKDKDMA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |