C23H24N6O4 — CID 90628352
(4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-11-yl)-[3-(3,4,5-trimethoxyphenyl)-1H-pyrazol-5-yl]methanone (PubChem CID 90628352) has the molecular formula C23H24N6O4 and a molecular weight of 448.48 g/mol. Its IUPAC name is (4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-11-yl)-[3-(3,4,5-trimethoxyphenyl)-1H-pyrazol-5-yl]methanone.
| Compound Name | (4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-11-yl)-[3-(3,4,5-trimethoxyphenyl)-1H-pyrazol-5-yl]methanone |
|---|---|
| PubChem CID | 90628352 |
| Molecular Formula | C23H24N6O4 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | (4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-11-yl)-[3-(3,4,5-trimethoxyphenyl)-1H-pyrazol-5-yl]methanone |
| SMILES | COc1cc(-c2cc(C(=O)N3CCc4c(cnc5cc(C)nn45)C3)[nH]n2)cc(OC)c1OC |
| InChI | InChI=1S/C23H24N6O4/c1-13-7-21-24-11-15-12-28(6-5-18(15)29(21)27-13)23(30)17-10-16(25-26-17)14-8-19(31-2)22(33-4)20(9-14)32-3/h7-11H,5-6,12H2,1-4H3,(H,25,26) |
| InChIKey | WXSLGEDJXJLDGS-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |