C16H20N4O — CID 90628304
cyclopentyl-(4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-11-yl)methanone (PubChem CID 90628304) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is cyclopentyl-(4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-11-yl)methanone.
| Compound Name | cyclopentyl-(4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-11-yl)methanone |
|---|---|
| PubChem CID | 90628304 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | cyclopentyl-(4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-11-yl)methanone |
| SMILES | Cc1cc2ncc3c(n2n1)CCN(C(=O)C1CCCC1)C3 |
| InChI | InChI=1S/C16H20N4O/c1-11-8-15-17-9-13-10-19(7-6-14(13)20(15)18-11)16(21)12-4-2-3-5-12/h8-9,12H,2-7,10H2,1H3 |
| InChIKey | HGMVTBSAUAZBMP-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |