C21H25NO3 — CID 90635191
4-butoxy-N-(3,4-dihydro-1H-isochromen-3-ylmethyl)benzamide (PubChem CID 90635191) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is 4-butoxy-N-(3,4-dihydro-1H-isochromen-3-ylmethyl)benzamide.
| Compound Name | 4-butoxy-N-(3,4-dihydro-1H-isochromen-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 90635191 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 4-butoxy-N-(3,4-dihydro-1H-isochromen-3-ylmethyl)benzamide |
| SMILES | CCCCOc1ccc(C(=O)NCC2Cc3ccccc3CO2)cc1 |
| InChI | InChI=1S/C21H25NO3/c1-2-3-12-24-19-10-8-16(9-11-19)21(23)22-14-20-13-17-6-4-5-7-18(17)15-25-20/h4-11,20H,2-3,12-15H2,1H3,(H,22,23) |
| InChIKey | UFCDXOQKWWRYFB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|