C16H16FN3O2S — CID 90636191
2-(4-fluorophenyl)sulfanyl-1-(3-pyrazin-2-yloxypyrrolidin-1-yl)ethanone (PubChem CID 90636191) has the molecular formula C16H16FN3O2S and a molecular weight of 333.39 g/mol. Its IUPAC name is 2-(4-fluorophenyl)sulfanyl-1-(3-pyrazin-2-yloxypyrrolidin-1-yl)ethanone.
| Compound Name | 2-(4-fluorophenyl)sulfanyl-1-(3-pyrazin-2-yloxypyrrolidin-1-yl)ethanone |
|---|---|
| PubChem CID | 90636191 |
| Molecular Formula | C16H16FN3O2S |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 2-(4-fluorophenyl)sulfanyl-1-(3-pyrazin-2-yloxypyrrolidin-1-yl)ethanone |
| SMILES | O=C(CSc1ccc(F)cc1)N1CCC(Oc2cnccn2)C1 |
| InChI | InChI=1S/C16H16FN3O2S/c17-12-1-3-14(4-2-12)23-11-16(21)20-8-5-13(10-20)22-15-9-18-6-7-19-15/h1-4,6-7,9,13H,5,8,10-11H2 |
| InChIKey | FRQQRNBERYGHGS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |