C20H25N3O4 — CID 90641083
N-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]-2-(5,6,7,8-tetrahydroquinolin-4-yloxy)acetamide (PubChem CID 90641083) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is N-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]-2-(5,6,7,8-tetrahydroquinolin-4-yloxy)acetamide.
| Compound Name | N-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]-2-(5,6,7,8-tetrahydroquinolin-4-yloxy)acetamide |
|---|---|
| PubChem CID | 90641083 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | N-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]-2-(5,6,7,8-tetrahydroquinolin-4-yloxy)acetamide |
| SMILES | COCCOc1ncccc1CNC(=O)COc1ccnc2c1CCCC2 |
| InChI | InChI=1S/C20H25N3O4/c1-25-11-12-26-20-15(5-4-9-22-20)13-23-19(24)14-27-18-8-10-21-17-7-3-2-6-16(17)18/h4-5,8-10H,2-3,6-7,11-14H2,1H3,(H,23,24) |
| InChIKey | ZOMPOPCKRDRPBM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|