C19H30N2O2 — CID 90640940
N-octyl-2-(5,6,7,8-tetrahydroquinolin-4-yloxy)acetamide (PubChem CID 90640940) has the molecular formula C19H30N2O2 and a molecular weight of 318.46 g/mol. Its IUPAC name is N-octyl-2-(5,6,7,8-tetrahydroquinolin-4-yloxy)acetamide.
| Compound Name | N-octyl-2-(5,6,7,8-tetrahydroquinolin-4-yloxy)acetamide |
|---|---|
| PubChem CID | 90640940 |
| Molecular Formula | C19H30N2O2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | N-octyl-2-(5,6,7,8-tetrahydroquinolin-4-yloxy)acetamide |
| SMILES | CCCCCCCCNC(=O)COc1ccnc2c1CCCC2 |
| InChI | InChI=1S/C19H30N2O2/c1-2-3-4-5-6-9-13-21-19(22)15-23-18-12-14-20-17-11-8-7-10-16(17)18/h12,14H,2-11,13,15H2,1H3,(H,21,22) |
| InChIKey | GDAFKHYZIKEXIZ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|