C18H16N2O2S2 — CID 90655206
2-hydroxy-5-methyl-2-(10H-phenothiazin-2-yl)-3H-1,4-thiazine-4-carbaldehyde (PubChem CID 90655206) has the molecular formula C18H16N2O2S2 and a molecular weight of 356.47 g/mol. Its IUPAC name is 2-hydroxy-5-methyl-2-(10H-phenothiazin-2-yl)-3H-1,4-thiazine-4-carbaldehyde.
| Compound Name | 2-hydroxy-5-methyl-2-(10H-phenothiazin-2-yl)-3H-1,4-thiazine-4-carbaldehyde |
|---|---|
| PubChem CID | 90655206 |
| Molecular Formula | C18H16N2O2S2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 2-hydroxy-5-methyl-2-(10H-phenothiazin-2-yl)-3H-1,4-thiazine-4-carbaldehyde |
| SMILES | CC1=CSC(O)(c2ccc3c(c2)Nc2ccccc2S3)CN1C=O |
| InChI | InChI=1S/C18H16N2O2S2/c1-12-9-23-18(22,10-20(12)11-21)13-6-7-17-15(8-13)19-14-4-2-3-5-16(14)24-17/h2-9,11,19,22H,10H2,1H3 |
| InChIKey | WOFQMTUYDHXBLJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|