C21H18N2OS2 — CID 86276223
4-methyl-2-(10H-phenothiazin-2-yl)-3H-1,4-benzothiazin-2-ol (PubChem CID 86276223) has the molecular formula C21H18N2OS2 and a molecular weight of 378.52 g/mol. Its IUPAC name is 4-methyl-2-(10H-phenothiazin-2-yl)-3H-1,4-benzothiazin-2-ol.
| Compound Name | 4-methyl-2-(10H-phenothiazin-2-yl)-3H-1,4-benzothiazin-2-ol |
|---|---|
| PubChem CID | 86276223 |
| Molecular Formula | C21H18N2OS2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 4-methyl-2-(10H-phenothiazin-2-yl)-3H-1,4-benzothiazin-2-ol |
| SMILES | CN1CC(O)(c2ccc3c(c2)Nc2ccccc2S3)Sc2ccccc21 |
| InChI | InChI=1S/C21H18N2OS2/c1-23-13-21(24,26-20-9-5-3-7-17(20)23)14-10-11-19-16(12-14)22-15-6-2-4-8-18(15)25-19/h2-12,22,24H,13H2,1H3 |
| InChIKey | SNMAXXFALXQUCH-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |