C15H17O4- — CID 90657849
(4aR,9aR)-8,8-dimethyl-1-methylidene-3-oxo-4a,6a,7,9-tetrahydro-4H-pentaleno[6a,1-c]pyran-5-carboxylate (PubChem CID 90657849) has the molecular formula C15H17O4- and a molecular weight of 261.30 g/mol. Its IUPAC name is (4aR,9aR)-8,8-dimethyl-1-methylidene-3-oxo-4a,6a,7,9-tetrahydro-4H-pentaleno[6a,1-c]pyran-5-carboxylate.
| Compound Name | (4aR,9aR)-8,8-dimethyl-1-methylidene-3-oxo-4a,6a,7,9-tetrahydro-4H-pentaleno[6a,1-c]pyran-5-carboxylate |
|---|---|
| PubChem CID | 90657849 |
| Molecular Formula | C15H17O4- |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | (4aR,9aR)-8,8-dimethyl-1-methylidene-3-oxo-4a,6a,7,9-tetrahydro-4H-pentaleno[6a,1-c]pyran-5-carboxylate |
| SMILES | C=C1OC(=O)C[C@H]2C(C(=O)[O-])=CC3CC(C)(C)C[C@@]132 |
| InChI | InChI=1S/C15H18O4/c1-8-15-7-14(2,3)6-9(15)4-10(13(17)18)11(15)5-12(16)19-8/h4,9,11H,1,5-7H2,2-3H3,(H,17,18)/p-1/t9?,11-,15+/m0/s1 |
| InChIKey | NMQMLYMVPLMPSU-BRIYQRAZSA-M |
| XLogP | 1.18 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |