C26H41NO6 — CID 90662012
[(2R,3R,4S,5S,6S,8R,10R,13R,16S,17R,18R)-11-ethyl-4-hydroxy-6,8,16-trimethoxy-13-methyl-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-18-yl] acetate (PubChem CID 90662012) has the molecular formula C26H41NO6 and a molecular weight of 463.62 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S,8R,10R,13R,16S,17R,18R)-11-ethyl-4-hydroxy-6,8,16-trimethoxy-13-methyl-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-18-yl] acetate.
| Compound Name | [(2R,3R,4S,5S,6S,8R,10R,13R,16S,17R,18R)-11-ethyl-4-hydroxy-6,8,16-trimethoxy-13-methyl-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-18-yl] acetate |
|---|---|
| PubChem CID | 90662012 |
| Molecular Formula | C26H41NO6 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.29 |
| IUPAC Name | [(2R,3R,4S,5S,6S,8R,10R,13R,16S,17R,18R)-11-ethyl-4-hydroxy-6,8,16-trimethoxy-13-methyl-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-18-yl] acetate |
| SMILES | CCN1C[C@]2(C)CCC(OC)C34[C@@H]5C[C@H]6[C@H](O)[C@@H]5[C@](OC)(C[C@@H]6OC)C(C(OC(C)=O)[C@@H]32)[C@@H]14 |
| InChI | InChI=1S/C26H41NO6/c1-7-27-12-24(3)9-8-17(31-5)26-15-10-14-16(30-4)11-25(32-6,18(15)20(14)29)19(23(26)27)21(22(24)26)33-13(2)28/h14-23,29H,7-12H2,1-6H3/t14-,15-,16+,17?,18-,19?,20+,21?,22-,23-,24+,25-,26?/m1/s1 |
| InChIKey | FWZLYKYJQSQEPN-TYZXYHTOSA-N |
| XLogP | 2.10 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |