C19H19Cl2N5O2 — CID 90664902
3-(6-morpholin-4-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-4-yl)aniline;dihydrochloride (PubChem CID 90664902) has the molecular formula C19H19Cl2N5O2 and a molecular weight of 420.30 g/mol. Its IUPAC name is 3-(6-morpholin-4-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-4-yl)aniline;dihydrochloride.
| Compound Name | 3-(6-morpholin-4-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-4-yl)aniline;dihydrochloride |
|---|---|
| PubChem CID | 90664902 |
| Molecular Formula | C19H19Cl2N5O2 |
| Molecular Weight | 420.30 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | 3-(6-morpholin-4-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-4-yl)aniline;dihydrochloride |
| SMILES | Cl.Cl.Nc1cccc(-c2nc(N3CCOCC3)c3oc4ncccc4c3n2)c1 |
| InChI | InChI=1S/C19H17N5O2.2ClH/c20-13-4-1-3-12(11-13)17-22-15-14-5-2-6-21-19(14)26-16(15)18(23-17)24-7-9-25-10-8-24;;/h1-6,11H,7-10,20H2;2*1H |
| InChIKey | YAVNKBSCZXWFJA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.30 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|