C18H30Cl2N4O2 — CID 90665025
(2S)-N-[1-(3-aminopropylamino)-2-methyl-1-oxo-3-phenylpropan-2-yl]pyrrolidine-2-carboxamide;dihydrochloride (PubChem CID 90665025) has the molecular formula C18H30Cl2N4O2 and a molecular weight of 405.37 g/mol. Its IUPAC name is (2S)-N-[1-(3-aminopropylamino)-2-methyl-1-oxo-3-phenylpropan-2-yl]pyrrolidine-2-carboxamide;dihydrochloride.
| Compound Name | (2S)-N-[1-(3-aminopropylamino)-2-methyl-1-oxo-3-phenylpropan-2-yl]pyrrolidine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 90665025 |
| Molecular Formula | C18H30Cl2N4O2 |
| Molecular Weight | 405.37 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | (2S)-N-[1-(3-aminopropylamino)-2-methyl-1-oxo-3-phenylpropan-2-yl]pyrrolidine-2-carboxamide;dihydrochloride |
| SMILES | CC(Cc1ccccc1)(NC(=O)[C@@H]1CCCN1)C(=O)NCCCN.Cl.Cl |
| InChI | InChI=1S/C18H28N4O2.2ClH/c1-18(17(24)21-12-6-10-19,13-14-7-3-2-4-8-14)22-16(23)15-9-5-11-20-15;;/h2-4,7-8,15,20H,5-6,9-13,19H2,1H3,(H,21,24)(H,22,23);2*1H/t15-,18?;;/m0../s1 |
| InChIKey | PYIQGZLOKLESQF-DOPMPYFGSA-N |
| XLogP | 1.16 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.37 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|