C21H20ClFN2OS — CID 90666951
(2Z)-2-[(E)-3-(3-ethyl-5-fluoro-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-3,5-dimethyl-1,3-benzoxazole chloride (PubChem CID 90666951) has the molecular formula C21H20ClFN2OS and a molecular weight of 402.92 g/mol. Its IUPAC name is (2Z)-2-[(E)-3-(3-ethyl-5-fluoro-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-3,5-dimethyl-1,3-benzoxazole chloride.
| Compound Name | (2Z)-2-[(E)-3-(3-ethyl-5-fluoro-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-3,5-dimethyl-1,3-benzoxazole chloride |
|---|---|
| PubChem CID | 90666951 |
| Molecular Formula | C21H20ClFN2OS |
| Molecular Weight | 402.92 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | (2Z)-2-[(E)-3-(3-ethyl-5-fluoro-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-3,5-dimethyl-1,3-benzoxazole chloride |
| SMILES | CC[n+]1c(/C=C/C=C2\Oc3ccc(C)cc3N2C)sc2ccc(F)cc21.[Cl-] |
| InChI | InChI=1S/C21H20FN2OS.ClH/c1-4-24-17-13-15(22)9-11-19(17)26-21(24)7-5-6-20-23(3)16-12-14(2)8-10-18(16)25-20;/h5-13H,4H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | KUNXNVKYHPMPCU-UHFFFAOYSA-M |
| XLogP | 2.04 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.92 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|