C30H37N5O2S — CID 90667049
cis-(1R,3S)-N-[2-(cyclopentanecarbonylamino)-1,3-benzothiazol-6-yl]-3-(5,6,7,8-tetrahydroquinolin-6-ylmethylamino)cyclohexane-1-carboxamide (PubChem CID 90667049) has the molecular formula C30H37N5O2S and a molecular weight of 531.73 g/mol. Its IUPAC name is cis-(1R,3S)-N-[2-(cyclopentanecarbonylamino)-1,3-benzothiazol-6-yl]-3-(5,6,7,8-tetrahydroquinolin-6-ylmethylamino)cyclohexane-1-carboxamide.
| Compound Name | cis-(1R,3S)-N-[2-(cyclopentanecarbonylamino)-1,3-benzothiazol-6-yl]-3-(5,6,7,8-tetrahydroquinolin-6-ylmethylamino)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 90667049 |
| Molecular Formula | C30H37N5O2S |
| Molecular Weight | 531.73 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | cis-(1R,3S)-N-[2-(cyclopentanecarbonylamino)-1,3-benzothiazol-6-yl]-3-(5,6,7,8-tetrahydroquinolin-6-ylmethylamino)cyclohexane-1-carboxamide |
| SMILES | O=C(Nc1nc2ccc(NC(=O)[C@@H]3CCC[C@H](NCC4CCc5ncccc5C4)C3)cc2s1)C1CCCC1 |
| InChI | InChI=1S/C30H37N5O2S/c36-28(20-5-1-2-6-20)35-30-34-26-13-11-24(17-27(26)38-30)33-29(37)22-7-3-9-23(16-22)32-18-19-10-12-25-21(15-19)8-4-14-31-25/h4,8,11,13-14,17,19-20,22-23,32H,1-3,5-7,9-10,12,15-16,18H2,(H,33,37)(H,34,35,36)/t19?,22-,23+/m1/s1 |
| InChIKey | UGHYNFYBSSXCOO-XDQLBQEWSA-N |
| XLogP | 5.71 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.73 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |