C30H48N10O4S2 — CID 90668718
(1E)-2-[6-[[amino-[(E)-[amino-(4-butylsulfonylanilino)methylidene]amino]methylidene]amino]hexyl]-1-[amino-(4-butylsulfonylanilino)methylidene]guanidine (PubChem CID 90668718) has the molecular formula C30H48N10O4S2 and a molecular weight of 676.91 g/mol. Its IUPAC name is (1E)-2-[6-[[amino-[(E)-[amino-(4-butylsulfonylanilino)methylidene]amino]methylidene]amino]hexyl]-1-[amino-(4-butylsulfonylanilino)methylidene]guanidine.
| Compound Name | (1E)-2-[6-[[amino-[(E)-[amino-(4-butylsulfonylanilino)methylidene]amino]methylidene]amino]hexyl]-1-[amino-(4-butylsulfonylanilino)methylidene]guanidine |
|---|---|
| PubChem CID | 90668718 |
| Molecular Formula | C30H48N10O4S2 |
| Molecular Weight | 676.91 g/mol |
| Exact Mass | 676.33 |
| IUPAC Name | (1E)-2-[6-[[amino-[(E)-[amino-(4-butylsulfonylanilino)methylidene]amino]methylidene]amino]hexyl]-1-[amino-(4-butylsulfonylanilino)methylidene]guanidine |
| SMILES | CCCCS(=O)(=O)c1ccc(N/C(N)=N/C(N)=N/CCCCCC/N=C(N)/N=C(\N)Nc2ccc(S(=O)(=O)CCCC)cc2)cc1 |
| InChI | InChI=1S/C30H48N10O4S2/c1-3-5-21-45(41,42)25-15-11-23(12-16-25)37-29(33)39-27(31)35-19-9-7-8-10-20-36-28(32)40-30(34)38-24-13-17-26(18-14-24)46(43,44)22-6-4-2/h11-18H,3-10,19-22H2,1-2H3,(H5,31,33,35,37,39)(H5,32,34,36,38,40) |
| InChIKey | WAPLWTZXTUZHLR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 245.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.91 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|