C23H19Cl2F6NO — CID 90668830
1-[6,7-dichloro-2,4-bis(trifluoromethyl)phenanthren-9-yl]-2-piperidin-2-ylethanol (PubChem CID 90668830) has the molecular formula C23H19Cl2F6NO and a molecular weight of 510.31 g/mol. Its IUPAC name is 1-[6,7-dichloro-2,4-bis(trifluoromethyl)phenanthren-9-yl]-2-piperidin-2-ylethanol.
| Compound Name | 1-[6,7-dichloro-2,4-bis(trifluoromethyl)phenanthren-9-yl]-2-piperidin-2-ylethanol |
|---|---|
| PubChem CID | 90668830 |
| Molecular Formula | C23H19Cl2F6NO |
| Molecular Weight | 510.31 g/mol |
| Exact Mass | 509.07 |
| IUPAC Name | 1-[6,7-dichloro-2,4-bis(trifluoromethyl)phenanthren-9-yl]-2-piperidin-2-ylethanol |
| SMILES | OC(CC1CCCCN1)c1cc2cc(C(F)(F)F)cc(C(F)(F)F)c2c2cc(Cl)c(Cl)cc12 |
| InChI | InChI=1S/C23H19Cl2F6NO/c24-18-9-14-15(20(33)8-13-3-1-2-4-32-13)6-11-5-12(22(26,27)28)7-17(23(29,30)31)21(11)16(14)10-19(18)25/h5-7,9-10,13,20,32-33H,1-4,8H2 |
| InChIKey | CLWVBHOONGBPQC-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.31 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|