C21H20Cl3NO — CID 90668908
2-piperidin-2-yl-1-(2,3,6-trichlorophenanthren-9-yl)ethanol (PubChem CID 90668908) has the molecular formula C21H20Cl3NO and a molecular weight of 408.76 g/mol. Its IUPAC name is 2-piperidin-2-yl-1-(2,3,6-trichlorophenanthren-9-yl)ethanol.
| Compound Name | 2-piperidin-2-yl-1-(2,3,6-trichlorophenanthren-9-yl)ethanol |
|---|---|
| PubChem CID | 90668908 |
| Molecular Formula | C21H20Cl3NO |
| Molecular Weight | 408.76 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | 2-piperidin-2-yl-1-(2,3,6-trichlorophenanthren-9-yl)ethanol |
| SMILES | OC(CC1CCCCN1)c1cc2cc(Cl)c(Cl)cc2c2cc(Cl)ccc12 |
| InChI | InChI=1S/C21H20Cl3NO/c22-13-4-5-15-17(9-13)16-11-20(24)19(23)8-12(16)7-18(15)21(26)10-14-3-1-2-6-25-14/h4-5,7-9,11,14,21,25-26H,1-3,6,10H2 |
| InChIKey | HSHXKUQLSQCFHT-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.76 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|