C22H21Cl3N2O2 — CID 90669141
1-[6,8-dichloro-2-(4-chlorophenoxy)quinolin-4-yl]-2-piperidin-2-ylethanol (PubChem CID 90669141) has the molecular formula C22H21Cl3N2O2 and a molecular weight of 451.78 g/mol. Its IUPAC name is 1-[6,8-dichloro-2-(4-chlorophenoxy)quinolin-4-yl]-2-piperidin-2-ylethanol.
| Compound Name | 1-[6,8-dichloro-2-(4-chlorophenoxy)quinolin-4-yl]-2-piperidin-2-ylethanol |
|---|---|
| PubChem CID | 90669141 |
| Molecular Formula | C22H21Cl3N2O2 |
| Molecular Weight | 451.78 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | 1-[6,8-dichloro-2-(4-chlorophenoxy)quinolin-4-yl]-2-piperidin-2-ylethanol |
| SMILES | OC(CC1CCCCN1)c1cc(Oc2ccc(Cl)cc2)nc2c(Cl)cc(Cl)cc12 |
| InChI | InChI=1S/C22H21Cl3N2O2/c23-13-4-6-16(7-5-13)29-21-12-17(20(28)11-15-3-1-2-8-26-15)18-9-14(24)10-19(25)22(18)27-21/h4-7,9-10,12,15,20,26,28H,1-3,8,11H2 |
| InChIKey | OMXJNDBXQGACGE-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.78 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |