C31H36F6N2O — CID 90669314
1-[2,6-bis[4-(trifluoromethyl)phenyl]-4-pyridinyl]-2-(dipentylamino)ethanol (PubChem CID 90669314) has the molecular formula C31H36F6N2O and a molecular weight of 566.63 g/mol. Its IUPAC name is 1-[2,6-bis[4-(trifluoromethyl)phenyl]-4-pyridinyl]-2-(dipentylamino)ethanol.
| Compound Name | 1-[2,6-bis[4-(trifluoromethyl)phenyl]-4-pyridinyl]-2-(dipentylamino)ethanol |
|---|---|
| PubChem CID | 90669314 |
| Molecular Formula | C31H36F6N2O |
| Molecular Weight | 566.63 g/mol |
| Exact Mass | 566.27 |
| IUPAC Name | 1-[2,6-bis[4-(trifluoromethyl)phenyl]-4-pyridinyl]-2-(dipentylamino)ethanol |
| SMILES | CCCCCN(CCCCC)CC(O)c1cc(-c2ccc(C(F)(F)F)cc2)nc(-c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C31H36F6N2O/c1-3-5-7-17-39(18-8-6-4-2)21-29(40)24-19-27(22-9-13-25(14-10-22)30(32,33)34)38-28(20-24)23-11-15-26(16-12-23)31(35,36)37/h9-16,19-20,29,40H,3-8,17-18,21H2,1-2H3 |
| InChIKey | MPHJMDVXKLISDX-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.63 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|