C17H17FN2O2S — CID 90670340
methyl (Z)-2-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-3-(4-fluorophenyl)prop-2-enoate (PubChem CID 90670340) has the molecular formula C17H17FN2O2S and a molecular weight of 332.40 g/mol. Its IUPAC name is methyl (Z)-2-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-3-(4-fluorophenyl)prop-2-enoate.
| Compound Name | methyl (Z)-2-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-3-(4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 90670340 |
| Molecular Formula | C17H17FN2O2S |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | methyl (Z)-2-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-3-(4-fluorophenyl)prop-2-enoate |
| SMILES | COC(=O)/C(=C/c1ccc(F)cc1)CSc1nc(C)cc(C)n1 |
| InChI | InChI=1S/C17H17FN2O2S/c1-11-8-12(2)20-17(19-11)23-10-14(16(21)22-3)9-13-4-6-15(18)7-5-13/h4-9H,10H2,1-3H3/b14-9+ |
| InChIKey | CFLVXEAXQWIHDB-NTEUORMPSA-N |
| XLogP | 3.58 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|