C26H26N2O5 — CID 90672164
(6aR,9S)-9-(4-methoxyphenyl)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline;(Z)-but-2-enedioic acid (PubChem CID 90672164) has the molecular formula C26H26N2O5 and a molecular weight of 446.50 g/mol. Its IUPAC name is (6aR,9S)-9-(4-methoxyphenyl)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline;(Z)-but-2-enedioic acid.
| Compound Name | (6aR,9S)-9-(4-methoxyphenyl)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 90672164 |
| Molecular Formula | C26H26N2O5 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | (6aR,9S)-9-(4-methoxyphenyl)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline;(Z)-but-2-enedioic acid |
| SMILES | COc1ccc([C@@H]2C=C3c4cccc5[nH]cc(c45)C[C@H]3N(C)C2)cc1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C22H22N2O.C4H4O4/c1-24-13-16(14-6-8-17(25-2)9-7-14)10-19-18-4-3-5-20-22(18)15(12-23-20)11-21(19)24;5-3(6)1-2-4(7)8/h3-10,12,16,21,23H,11,13H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1-/t16-,21-;/m1./s1 |
| InChIKey | MRTCCSXPTRVSSH-HYTRZONSSA-N |
| XLogP | 3.93 |
| TPSA | 102.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|