C17H13NO3S — CID 90673434
methyl 4-oxo-8-phenylsulfanyl-1H-quinoline-2-carboxylate (PubChem CID 90673434) has the molecular formula C17H13NO3S and a molecular weight of 311.36 g/mol. Its IUPAC name is methyl 4-oxo-8-phenylsulfanyl-1H-quinoline-2-carboxylate.
| Compound Name | methyl 4-oxo-8-phenylsulfanyl-1H-quinoline-2-carboxylate |
|---|---|
| PubChem CID | 90673434 |
| Molecular Formula | C17H13NO3S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | methyl 4-oxo-8-phenylsulfanyl-1H-quinoline-2-carboxylate |
| SMILES | COC(=O)c1cc(=O)c2cccc(Sc3ccccc3)c2[nH]1 |
| InChI | InChI=1S/C17H13NO3S/c1-21-17(20)13-10-14(19)12-8-5-9-15(16(12)18-13)22-11-6-3-2-4-7-11/h2-10H,1H3,(H,18,19) |
| InChIKey | GJFSTBOESFWFCQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |