methyl 4-oxo-7H-thieno[2,3-b]pyridine-6-carboxylate

C9H7NO3S — CID 15166985

IUPACmethyl 4-oxo-7H-thieno[2,3-b]pyridine-6-carboxylate
SMILESCOC(=O)c1cc(=O)c2ccsc2[nH]1
InChIInChI=1S/C9H7NO3S/c1-13-9(12)6-4-7(11)5-2-3-14-8(5)10-6/h2-4H,1H3,(H,10,11)
InChIKeyVRJSDVWMQMEGQU-UHFFFAOYSA-N
MW209.23 g/mol
LogP1.38
Rot. Bonds1

About methyl 4-oxo-7H-thieno[2,3-b]pyridine-6-carboxylate

methyl 4-oxo-7H-thieno[2,3-b]pyridine-6-carboxylate (PubChem CID 15166985) has the molecular formula C9H7NO3S and a molecular weight of 209.23 g/mol. Its IUPAC name is methyl 4-oxo-7H-thieno[2,3-b]pyridine-6-carboxylate.

Molecular Properties

Compound Namemethyl 4-oxo-7H-thieno[2,3-b]pyridine-6-carboxylate
PubChem CID15166985
Molecular FormulaC9H7NO3S
Molecular Weight209.23 g/mol
Exact Mass209.01
IUPAC Namemethyl 4-oxo-7H-thieno[2,3-b]pyridine-6-carboxylate
SMILESCOC(=O)c1cc(=O)c2ccsc2[nH]1
InChIInChI=1S/C9H7NO3S/c1-13-9(12)6-4-7(11)5-2-3-14-8(5)10-6/h2-4H,1H3,(H,10,11)
InChIKeyVRJSDVWMQMEGQU-UHFFFAOYSA-N
XLogP1.38
TPSA59.16 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.23
LogP ≤ 51.38
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 4-oxo-7H-thieno[2,3-b]pyridine-6-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-oxo-7H-thieno[2,3-b]pyridine-6-carboxylate?
The IUPAC name of methyl 4-oxo-7H-thieno[2,3-b]pyridine-6-carboxylate (CID 15166985) is methyl 4-oxo-7H-thieno[2,3-b]pyridine-6-carboxylate.
What is the SMILES notation for methyl 4-oxo-7H-thieno[2,3-b]pyridine-6-carboxylate?
The canonical SMILES for methyl 4-oxo-7H-thieno[2,3-b]pyridine-6-carboxylate is COC(=O)c1cc(=O)c2ccsc2[nH]1.
What is the InChIKey of methyl 4-oxo-7H-thieno[2,3-b]pyridine-6-carboxylate?
The InChIKey is VRJSDVWMQMEGQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO3S/c1-13-9(12)6-4-7(11)5-2-3-14-8(5)10-6/h2-4H,1H3,(H,10,11).
What are the key properties of methyl 4-oxo-7H-thieno[2,3-b]pyridine-6-carboxylate?
methyl 4-oxo-7H-thieno[2,3-b]pyridine-6-carboxylate has a molecular weight of 209.23 g/mol, XLogP of 1.38, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-oxo-7H-thieno[2,3-b]pyridine-6-carboxylate is sourced from PubChem (CID 15166985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).