C17H16N2O — CID 90675548
9-methoxy-4-[(1E,3E)-penta-1,3-dienyl]pyrrolo[1,2-a]quinoxaline (PubChem CID 90675548) has the molecular formula C17H16N2O and a molecular weight of 264.33 g/mol. Its IUPAC name is 9-methoxy-4-[(1E,3E)-penta-1,3-dienyl]pyrrolo[1,2-a]quinoxaline.
| Compound Name | 9-methoxy-4-[(1E,3E)-penta-1,3-dienyl]pyrrolo[1,2-a]quinoxaline |
|---|---|
| PubChem CID | 90675548 |
| Molecular Formula | C17H16N2O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 9-methoxy-4-[(1E,3E)-penta-1,3-dienyl]pyrrolo[1,2-a]quinoxaline |
| SMILES | C/C=C/C=C/c1nc2cccc(OC)c2n2cccc12 |
| InChI | InChI=1S/C17H16N2O/c1-3-4-5-8-13-15-10-7-12-19(15)17-14(18-13)9-6-11-16(17)20-2/h3-12H,1-2H3/b4-3+,8-5+ |
| InChIKey | BOZOOHPCCIMVTG-SALQQRKASA-N |
| XLogP | 4.09 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|