C21H25NO5S — CID 9067799
[2-(4-ethylanilino)-2-oxoethyl] 3-(3,4-dimethylphenyl)sulfonylpropanoate (PubChem CID 9067799) has the molecular formula C21H25NO5S and a molecular weight of 403.50 g/mol. Its IUPAC name is [2-(4-ethylanilino)-2-oxoethyl] 3-(3,4-dimethylphenyl)sulfonylpropanoate.
| Compound Name | [2-(4-ethylanilino)-2-oxoethyl] 3-(3,4-dimethylphenyl)sulfonylpropanoate |
|---|---|
| PubChem CID | 9067799 |
| Molecular Formula | C21H25NO5S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | [2-(4-ethylanilino)-2-oxoethyl] 3-(3,4-dimethylphenyl)sulfonylpropanoate |
| SMILES | CCc1ccc(NC(=O)COC(=O)CCS(=O)(=O)c2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C21H25NO5S/c1-4-17-6-8-18(9-7-17)22-20(23)14-27-21(24)11-12-28(25,26)19-10-5-15(2)16(3)13-19/h5-10,13H,4,11-12,14H2,1-3H3,(H,22,23) |
| InChIKey | MEARASJWZJJPSZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |