C26H36N2O4 — CID 90679298
(3E,5S,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-3-(2-methyl-4-nitrophenoxy)imino-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 90679298) has the molecular formula C26H36N2O4 and a molecular weight of 440.58 g/mol. Its IUPAC name is (3E,5S,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-3-(2-methyl-4-nitrophenoxy)imino-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (3E,5S,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-3-(2-methyl-4-nitrophenoxy)imino-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 90679298 |
| Molecular Formula | C26H36N2O4 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | (3E,5S,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-3-(2-methyl-4-nitrophenoxy)imino-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | Cc1cc([N+](=O)[O-])ccc1O/N=C1\CC[C@@]2(C)[C@@H](CC[C@@H]3[C@@H]2CC[C@]2(C)[C@@H](O)CC[C@@H]32)C1 |
| InChI | InChI=1S/C26H36N2O4/c1-16-14-19(28(30)31)5-8-23(16)32-27-18-10-12-25(2)17(15-18)4-6-20-21-7-9-24(29)26(21,3)13-11-22(20)25/h5,8,14,17,20-22,24,29H,4,6-7,9-13,15H2,1-3H3/b27-18+/t17-,20-,21-,22-,24-,25-,26-/m0/s1 |
| InChIKey | CXXQPGGFVOBNMP-PVGSUHDKSA-N |
| XLogP | 6.04 |
| TPSA | 84.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|