C14H24N2O3 — CID 90679577
5-butyl-5-(3,3-dimethylbutan-2-yl)-1,3-diazinane-2,4,6-trione (PubChem CID 90679577) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is 5-butyl-5-(3,3-dimethylbutan-2-yl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-butyl-5-(3,3-dimethylbutan-2-yl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 90679577 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 5-butyl-5-(3,3-dimethylbutan-2-yl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCCCC1(C(C)C(C)(C)C)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C14H24N2O3/c1-6-7-8-14(9(2)13(3,4)5)10(17)15-12(19)16-11(14)18/h9H,6-8H2,1-5H3,(H2,15,16,17,18,19) |
| InChIKey | DTTVVKNADBHJKB-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|