C15H25N2NaO2S2 — CID 23706627
sodium 5-butyl-6-oxo-5-(1-pentylsulfanylethyl)-2-sulfanylidenepyrimidin-4-olate (PubChem CID 23706627) has the molecular formula C15H25N2NaO2S2 and a molecular weight of 352.50 g/mol. Its IUPAC name is sodium 5-butyl-6-oxo-5-(1-pentylsulfanylethyl)-2-sulfanylidenepyrimidin-4-olate.
| Compound Name | sodium 5-butyl-6-oxo-5-(1-pentylsulfanylethyl)-2-sulfanylidenepyrimidin-4-olate |
|---|---|
| PubChem CID | 23706627 |
| Molecular Formula | C15H25N2NaO2S2 |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | sodium 5-butyl-6-oxo-5-(1-pentylsulfanylethyl)-2-sulfanylidenepyrimidin-4-olate |
| SMILES | CCCCCSC(C)C1(CCCC)C(=O)NC(=S)N=C1[O-].[Na+] |
| InChI | InChI=1S/C15H26N2O2S2.Na/c1-4-6-8-10-21-11(3)15(9-7-5-2)12(18)16-14(20)17-13(15)19;/h11H,4-10H2,1-3H3,(H2,16,17,18,19,20);/q;+1/p-1 |
| InChIKey | MYFWFUHSHFHXRZ-UHFFFAOYSA-M |
| XLogP | -0.35 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|