C13H21N2NaO2S2 — CID 23706615
sodium 5-[1-(2-methylpropylsulfanyl)ethyl]-6-oxo-5-propyl-2-sulfanylidenepyrimidin-4-olate (PubChem CID 23706615) has the molecular formula C13H21N2NaO2S2 and a molecular weight of 324.45 g/mol. Its IUPAC name is sodium 5-[1-(2-methylpropylsulfanyl)ethyl]-6-oxo-5-propyl-2-sulfanylidenepyrimidin-4-olate.
| Compound Name | sodium 5-[1-(2-methylpropylsulfanyl)ethyl]-6-oxo-5-propyl-2-sulfanylidenepyrimidin-4-olate |
|---|---|
| PubChem CID | 23706615 |
| Molecular Formula | C13H21N2NaO2S2 |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | sodium 5-[1-(2-methylpropylsulfanyl)ethyl]-6-oxo-5-propyl-2-sulfanylidenepyrimidin-4-olate |
| SMILES | CCCC1(C(C)SCC(C)C)C(=O)NC(=S)N=C1[O-].[Na+] |
| InChI | InChI=1S/C13H22N2O2S2.Na/c1-5-6-13(9(4)19-7-8(2)3)10(16)14-12(18)15-11(13)17;/h8-9H,5-7H2,1-4H3,(H2,14,15,16,17,18);/q;+1/p-1 |
| InChIKey | HJQLILKRMRHCNU-UHFFFAOYSA-M |
| XLogP | -1.27 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|