C13H19N2NaO2S — CID 23706636
sodium 5-but-3-en-2-yl-6-oxo-5-pentyl-2-sulfanylidenepyrimidin-4-olate (PubChem CID 23706636) has the molecular formula C13H19N2NaO2S and a molecular weight of 290.36 g/mol. Its IUPAC name is sodium 5-but-3-en-2-yl-6-oxo-5-pentyl-2-sulfanylidenepyrimidin-4-olate.
| Compound Name | sodium 5-but-3-en-2-yl-6-oxo-5-pentyl-2-sulfanylidenepyrimidin-4-olate |
|---|---|
| PubChem CID | 23706636 |
| Molecular Formula | C13H19N2NaO2S |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | sodium 5-but-3-en-2-yl-6-oxo-5-pentyl-2-sulfanylidenepyrimidin-4-olate |
| SMILES | C=CC(C)C1(CCCCC)C(=O)NC(=S)N=C1[O-].[Na+] |
| InChI | InChI=1S/C13H20N2O2S.Na/c1-4-6-7-8-13(9(3)5-2)10(16)14-12(18)15-11(13)17;/h5,9H,2,4,6-8H2,1,3H3,(H2,14,15,16,17,18);/q;+1/p-1 |
| InChIKey | GPNKDJXICLTJCQ-UHFFFAOYSA-M |
| XLogP | -1.45 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|