C14H23N2NaO2S2 — CID 23716048
sodium 5-(1-ethylsulfanylethyl)-5-hexyl-2-sulfanylidenepyrimidin-3-ide-4,6-dione (PubChem CID 23716048) has the molecular formula C14H23N2NaO2S2 and a molecular weight of 338.47 g/mol. Its IUPAC name is sodium 5-(1-ethylsulfanylethyl)-5-hexyl-2-sulfanylidenepyrimidin-3-ide-4,6-dione.
| Compound Name | sodium 5-(1-ethylsulfanylethyl)-5-hexyl-2-sulfanylidenepyrimidin-3-ide-4,6-dione |
|---|---|
| PubChem CID | 23716048 |
| Molecular Formula | C14H23N2NaO2S2 |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | sodium 5-(1-ethylsulfanylethyl)-5-hexyl-2-sulfanylidenepyrimidin-3-ide-4,6-dione |
| SMILES | CCCCCCC1(C(C)SCC)C(=O)[N-]C(=S)NC1=O.[Na+] |
| InChI | InChI=1S/C14H24N2O2S2.Na/c1-4-6-7-8-9-14(10(3)20-5-2)11(17)15-13(19)16-12(14)18;/h10H,4-9H2,1-3H3,(H2,15,16,17,18,19);/q;+1/p-1 |
| InChIKey | SPDYTFJFQNVAJR-UHFFFAOYSA-M |
| XLogP | 0.40 |
| TPSA | 60.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|