C20H36IN3O6 — CID 90680359
tert-butyl (2R)-2-[[(2S)-2-[(2-iodoacetyl)amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]propanoate (PubChem CID 90680359) has the molecular formula C20H36IN3O6 and a molecular weight of 541.43 g/mol. Its IUPAC name is tert-butyl (2R)-2-[[(2S)-2-[(2-iodoacetyl)amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]propanoate.
| Compound Name | tert-butyl (2R)-2-[[(2S)-2-[(2-iodoacetyl)amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]propanoate |
|---|---|
| PubChem CID | 90680359 |
| Molecular Formula | C20H36IN3O6 |
| Molecular Weight | 541.43 g/mol |
| Exact Mass | 541.16 |
| IUPAC Name | tert-butyl (2R)-2-[[(2S)-2-[(2-iodoacetyl)amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]propanoate |
| SMILES | C[C@@H](NC(=O)[C@H](CCCCNC(=O)OC(C)(C)C)NC(=O)CI)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H36IN3O6/c1-13(17(27)29-19(2,3)4)23-16(26)14(24-15(25)12-21)10-8-9-11-22-18(28)30-20(5,6)7/h13-14H,8-12H2,1-7H3,(H,22,28)(H,23,26)(H,24,25)/t13-,14+/m1/s1 |
| InChIKey | VSGVSMLUXIQVPW-KGLIPLIRSA-N |
| XLogP | 2.45 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|