C21H20N4O2 — CID 90681275
N-benzyl-4-(5,7-dimethoxyimidazo[1,2-a]pyrimidin-2-yl)aniline (PubChem CID 90681275) has the molecular formula C21H20N4O2 and a molecular weight of 360.42 g/mol. Its IUPAC name is N-benzyl-4-(5,7-dimethoxyimidazo[1,2-a]pyrimidin-2-yl)aniline.
| Compound Name | N-benzyl-4-(5,7-dimethoxyimidazo[1,2-a]pyrimidin-2-yl)aniline |
|---|---|
| PubChem CID | 90681275 |
| Molecular Formula | C21H20N4O2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | N-benzyl-4-(5,7-dimethoxyimidazo[1,2-a]pyrimidin-2-yl)aniline |
| SMILES | COc1cc(OC)n2cc(-c3ccc(NCc4ccccc4)cc3)nc2n1 |
| InChI | InChI=1S/C21H20N4O2/c1-26-19-12-20(27-2)25-14-18(23-21(25)24-19)16-8-10-17(11-9-16)22-13-15-6-4-3-5-7-15/h3-12,14,22H,13H2,1-2H3 |
| InChIKey | LYTWWFALGJUROX-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |