C20H24ClN3S — CID 90681589
1-(4-ethylpiperazin-1-yl)-6-methyl-3-thiophen-2-ylisoquinoline;hydrochloride (PubChem CID 90681589) has the molecular formula C20H24ClN3S and a molecular weight of 373.95 g/mol. Its IUPAC name is 1-(4-ethylpiperazin-1-yl)-6-methyl-3-thiophen-2-ylisoquinoline;hydrochloride.
| Compound Name | 1-(4-ethylpiperazin-1-yl)-6-methyl-3-thiophen-2-ylisoquinoline;hydrochloride |
|---|---|
| PubChem CID | 90681589 |
| Molecular Formula | C20H24ClN3S |
| Molecular Weight | 373.95 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 1-(4-ethylpiperazin-1-yl)-6-methyl-3-thiophen-2-ylisoquinoline;hydrochloride |
| SMILES | CCN1CCN(c2nc(-c3cccs3)cc3cc(C)ccc23)CC1.Cl |
| InChI | InChI=1S/C20H23N3S.ClH/c1-3-22-8-10-23(11-9-22)20-17-7-6-15(2)13-16(17)14-18(21-20)19-5-4-12-24-19;/h4-7,12-14H,3,8-11H2,1-2H3;1H |
| InChIKey | YWDWYODCFDQTPD-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.95 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |