C31H25N3O3 — CID 90682156
3-[[5-[1-[(3-methoxyphenyl)methyl]indol-6-yl]benzimidazol-1-yl]methyl]benzoic acid (PubChem CID 90682156) has the molecular formula C31H25N3O3 and a molecular weight of 487.56 g/mol. Its IUPAC name is 3-[[5-[1-[(3-methoxyphenyl)methyl]indol-6-yl]benzimidazol-1-yl]methyl]benzoic acid.
| Compound Name | 3-[[5-[1-[(3-methoxyphenyl)methyl]indol-6-yl]benzimidazol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 90682156 |
| Molecular Formula | C31H25N3O3 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | 3-[[5-[1-[(3-methoxyphenyl)methyl]indol-6-yl]benzimidazol-1-yl]methyl]benzoic acid |
| SMILES | COc1cccc(Cn2ccc3ccc(-c4ccc5c(c4)ncn5Cc4cccc(C(=O)O)c4)cc32)c1 |
| InChI | InChI=1S/C31H25N3O3/c1-37-27-7-3-5-22(15-27)18-33-13-12-23-8-9-25(17-30(23)33)24-10-11-29-28(16-24)32-20-34(29)19-21-4-2-6-26(14-21)31(35)36/h2-17,20H,18-19H2,1H3,(H,35,36) |
| InChIKey | XUKSTKMYOOLWBO-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |