C9H10F2N2O4Se — CID 90682961
5-fluoro-1-[(3S,4S,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)selenolan-2-yl]pyrimidine-2,4-dione (PubChem CID 90682961) has the molecular formula C9H10F2N2O4Se and a molecular weight of 327.15 g/mol. Its IUPAC name is 5-fluoro-1-[(3S,4S,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)selenolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-fluoro-1-[(3S,4S,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)selenolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 90682961 |
| Molecular Formula | C9H10F2N2O4Se |
| Molecular Weight | 327.15 g/mol |
| Exact Mass | 327.98 |
| IUPAC Name | 5-fluoro-1-[(3S,4S,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)selenolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(C2[Se][C@H](CO)[C@@H](O)[C@@H]2F)cc1F |
| InChI | InChI=1S/C9H10F2N2O4Se/c10-3-1-13(9(17)12-7(3)16)8-5(11)6(15)4(2-14)18-8/h1,4-6,8,14-15H,2H2,(H,12,16,17)/t4-,5+,6-,8?/m1/s1 |
| InChIKey | LXHYKRXEJHPVIG-NFRNADEISA-N |
| XLogP | -1.63 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.15 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|