C48H28F12N4 — CID 90685220
5,10,15,20-tetrakis[4-(trifluoromethyl)phenyl]-21,22,23,24-tetrahydroporphyrin (PubChem CID 90685220) has the molecular formula C48H28F12N4 and a molecular weight of 888.76 g/mol. Its IUPAC name is 5,10,15,20-tetrakis[4-(trifluoromethyl)phenyl]-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis[4-(trifluoromethyl)phenyl]-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 90685220 |
| Molecular Formula | C48H28F12N4 |
| Molecular Weight | 888.76 g/mol |
| Exact Mass | 888.21 |
| IUPAC Name | 5,10,15,20-tetrakis[4-(trifluoromethyl)phenyl]-21,22,23,24-tetrahydroporphyrin |
| SMILES | FC(F)(F)c1ccc(C2=c3ccc([nH]3)=C(c3ccc(C(F)(F)F)cc3)c3ccc([nH]3)C(c3ccc(C(F)(F)F)cc3)=c3ccc([nH]3)=C(c3ccc(C(F)(F)F)cc3)c3ccc2[nH]3)cc1 |
| InChI | InChI=1S/C48H28F12N4/c49-45(50,51)29-9-1-25(2-10-29)41-33-17-19-35(61-33)42(26-3-11-30(12-4-26)46(52,53)54)37-21-23-39(63-37)44(28-7-15-32(16-8-28)48(58,59)60)40-24-22-38(64-40)43(36-20-18-34(41)62-36)27-5-13-31(14-6-27)47(55,56)57/h1-24,61-64H |
| InChIKey | SVJVNQMKSNVZBW-UHFFFAOYSA-N |
| XLogP | 10.38 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 888.76 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |