C6H8O2 — CID 90687180
6,8-dioxabicyclo[3.2.1]oct-1-ene (PubChem CID 90687180) has the molecular formula C6H8O2 and a molecular weight of 112.13 g/mol. Its IUPAC name is 6,8-dioxabicyclo[3.2.1]oct-1-ene.
| Compound Name | 6,8-dioxabicyclo[3.2.1]oct-1-ene |
|---|---|
| PubChem CID | 90687180 |
| Molecular Formula | C6H8O2 |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.05 |
| IUPAC Name | 6,8-dioxabicyclo[3.2.1]oct-1-ene |
| SMILES | C1=C2COC(CC1)O2 |
| InChI | InChI=1S/C6H8O2/c1-2-5-4-7-6(3-1)8-5/h2,6H,1,3-4H2 |
| InChIKey | OFFLSTQZDBSOGQ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |