C26H22F5N3O3+2 — CID 90690020
3-[2,4-diethyl-7,9-difluoro-13-methoxy-8-(trifluoromethyl)-1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(11),5,7,9,12,14-hexaen-3-ylidene]-7-methylimidazo[1,5-c][1,3]oxazol-6-ium-1-one (PubChem CID 90690020) has the molecular formula C26H22F5N3O3+2 and a molecular weight of 519.47 g/mol. Its IUPAC name is 3-[2,4-diethyl-7,9-difluoro-13-methoxy-8-(trifluoromethyl)-1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(11),5,7,9,12,14-hexaen-3-ylidene]-7-methylimidazo[1,5-c][1,3]oxazol-6-ium-1-one.
| Compound Name | 3-[2,4-diethyl-7,9-difluoro-13-methoxy-8-(trifluoromethyl)-1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(11),5,7,9,12,14-hexaen-3-ylidene]-7-methylimidazo[1,5-c][1,3]oxazol-6-ium-1-one |
|---|---|
| PubChem CID | 90690020 |
| Molecular Formula | C26H22F5N3O3+2 |
| Molecular Weight | 519.47 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | 3-[2,4-diethyl-7,9-difluoro-13-methoxy-8-(trifluoromethyl)-1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(11),5,7,9,12,14-hexaen-3-ylidene]-7-methylimidazo[1,5-c][1,3]oxazol-6-ium-1-one |
| SMILES | CCC12C(=c3oc(=O)c4c(C)[nH+]cn34)C1(CC)[n+]1ccc(OC)cc1-c1c2cc(F)c(C(F)(F)F)c1F |
| InChI | InChI=1S/C26H21F5N3O3/c1-5-24-14-10-15(27)18(26(29,30)31)19(28)17(14)16-9-13(36-4)7-8-34(16)25(24,6-2)21(24)22-33-11-32-12(3)20(33)23(35)37-22/h7-11H,5-6H2,1-4H3/q+1/p+1 |
| InChIKey | HMJBDOOSTNDYNR-UHFFFAOYSA-O |
| XLogP | 3.63 |
| TPSA | 61.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|