C25H22F5N3O2+2 — CID 90984730
2,4-diethyl-7,9-difluoro-6',13-dimethyl-8-(trifluoromethyl)spiro[1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(11),5,7,9,12,14-hexaene-3,3'-imidazo[1,5-c][1,3]oxazol-6-ium]-1'-one (PubChem CID 90984730) has the molecular formula C25H22F5N3O2+2 and a molecular weight of 491.46 g/mol. Its IUPAC name is 2,4-diethyl-7,9-difluoro-6',13-dimethyl-8-(trifluoromethyl)spiro[1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(11),5,7,9,12,14-hexaene-3,3'-imidazo[1,5-c][1,3]oxazol-6-ium]-1'-one.
| Compound Name | 2,4-diethyl-7,9-difluoro-6',13-dimethyl-8-(trifluoromethyl)spiro[1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(11),5,7,9,12,14-hexaene-3,3'-imidazo[1,5-c][1,3]oxazol-6-ium]-1'-one |
|---|---|
| PubChem CID | 90984730 |
| Molecular Formula | C25H22F5N3O2+2 |
| Molecular Weight | 491.46 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | 2,4-diethyl-7,9-difluoro-6',13-dimethyl-8-(trifluoromethyl)spiro[1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(11),5,7,9,12,14-hexaene-3,3'-imidazo[1,5-c][1,3]oxazol-6-ium]-1'-one |
| SMILES | CCC12c3cc(F)c(C(F)(F)F)c(F)c3-c3cc(C)cc[n+]3C1(CC)C21OC(=O)c2c[n+](C)cn21 |
| InChI | InChI=1S/C25H22F5N3O2/c1-5-22-14-10-15(26)19(24(28,29)30)20(27)18(14)16-9-13(3)7-8-32(16)23(22,6-2)25(22)33-12-31(4)11-17(33)21(34)35-25/h7-12H,5-6H2,1-4H3/q+2 |
| InChIKey | BTBJPWUYUXMILJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 38.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.46 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|