C32H38F5N3O2+2 — CID 90896397
6-[6,6-diethyl-9,11-difluoro-2-hexyl-10-(trifluoromethyl)-7H-benzo[a]quinolizin-5-ium-7-yl]-2,3-dimethyl-5,6-dihydroimidazo[5,1-c][1,4]oxazin-2-ium-8-one (PubChem CID 90896397) has the molecular formula C32H38F5N3O2+2 and a molecular weight of 591.67 g/mol. Its IUPAC name is 6-[6,6-diethyl-9,11-difluoro-2-hexyl-10-(trifluoromethyl)-7H-benzo[a]quinolizin-5-ium-7-yl]-2,3-dimethyl-5,6-dihydroimidazo[5,1-c][1,4]oxazin-2-ium-8-one.
| Compound Name | 6-[6,6-diethyl-9,11-difluoro-2-hexyl-10-(trifluoromethyl)-7H-benzo[a]quinolizin-5-ium-7-yl]-2,3-dimethyl-5,6-dihydroimidazo[5,1-c][1,4]oxazin-2-ium-8-one |
|---|---|
| PubChem CID | 90896397 |
| Molecular Formula | C32H38F5N3O2+2 |
| Molecular Weight | 591.67 g/mol |
| Exact Mass | 591.29 |
| IUPAC Name | 6-[6,6-diethyl-9,11-difluoro-2-hexyl-10-(trifluoromethyl)-7H-benzo[a]quinolizin-5-ium-7-yl]-2,3-dimethyl-5,6-dihydroimidazo[5,1-c][1,4]oxazin-2-ium-8-one |
| SMILES | CCCCCCc1cc[n+]2c(c1)-c1c(cc(F)c(C(F)(F)F)c1F)C(C1Cn3c(c[n+](C)c3C)C(=O)O1)C2(CC)CC |
| InChI | InChI=1S/C32H38F5N3O2/c1-6-9-10-11-12-20-13-14-40-23(15-20)26-21(16-22(33)28(29(26)34)32(35,36)37)27(31(40,7-2)8-3)25-18-39-19(4)38(5)17-24(39)30(41)42-25/h13-17,25,27H,6-12,18H2,1-5H3/q+2 |
| InChIKey | OSDCPUQXOJUHRO-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 38.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.67 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|